| Name |
Boronic acid, (4-bromo-2,5-dibutylphenyl)-
|
| Molecular Formula |
C14H22BBrO2
|
| Molecular Weight |
313.04
|
| Smiles |
CCCCc1cc(B(O)O)c(CCCC)cc1Br
|
CCCCc1cc(B(O)O)c(CCCC)cc1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.