| Name |
6-(4H-1,2,4-Triazol-4-yl)-1,3,5-triazine-2,4(1H,3H)-dione
|
| Molecular Formula |
C5H4N6O2
|
| Molecular Weight |
180.12
|
| Smiles |
O=c1nc(-n2cnnc2)[nH]c(=O)[nH]1
|
O=c1nc(-n2cnnc2)[nH]c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.