| Name |
4-(2,2,2-Trifluoroacetyl)-3,4-dihydrospiro[1,4-benzoxazine-2,1'-cyclopropane]-6-carboxylic acid
|
| Molecular Formula |
C13H10F3NO4
|
| Molecular Weight |
301.22
|
| Smiles |
O=C(O)c1ccc2c(c1)N(C(=O)C(F)(F)F)CC1(CC1)O2
|
O=C(O)c1ccc2c(c1)N(C(=O)C(F)(F)F)CC1(CC1)O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.