| Name |
3-{1H-pyrrolo[2,3-b]pyridin-3-yl}-2-(2,2,2-trifluoroacetamido)propanoic acid
|
| Molecular Formula |
C12H10F3N3O3
|
| Molecular Weight |
301.22
|
| Smiles |
O=C(O)C(Cc1c[nH]c2ncccc12)NC(=O)C(F)(F)F
|
O=C(O)C(Cc1c[nH]c2ncccc12)NC(=O)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.