| Name |
5-(3-Ethynylphenyl)-1,2-oxazole-3-carboxylic acid
|
| Molecular Formula |
C12H7NO3
|
| Molecular Weight |
213.19
|
| Smiles |
C#Cc1cccc(-c2cc(C(=O)O)no2)c1
|
C#Cc1cccc(-c2cc(C(=O)O)no2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.