| Name |
2-Methyl-2-{[1,2,4]triazolo[1,5-a]pyrazin-5-yl}propanoic acid
|
| Molecular Formula |
C9H10N4O2
|
| Molecular Weight |
206.20
|
| Smiles |
CC(C)(C(=O)O)c1cncc2ncnn12
|
CC(C)(C(=O)O)c1cncc2ncnn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.