| Name |
1,4-Benzenediol, 2,5-bis(1,1-dimethylethyl)-, 1,4-dicarbamate
|
| Molecular Formula |
C16H24N2O4
|
| Molecular Weight |
308.37
|
| Smiles |
CC(C)(C)c1cc(OC(N)=O)c(C(C)(C)C)cc1OC(N)=O
|
CC(C)(C)c1cc(OC(N)=O)c(C(C)(C)C)cc1OC(N)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.