| Name |
sodium 2-(1-methyl-1H-1,2,4-triazol-3-yl)acetate
|
| Molecular Formula |
C5H6N3NaO2
|
| Molecular Weight |
163.11
|
| Smiles |
Cn1cnc(CC(=O)[O-])n1.[Na+]
|
Cn1cnc(CC(=O)[O-])n1.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.