| Name |
2-tert-Butyl 7-methyl 5-iodo-3,4-dihydroisoquinoline-2,7(1H)-dicarboxylate
|
| Molecular Formula |
C16H20INO4
|
| Molecular Weight |
417.24
|
| Smiles |
COC(=O)c1cc(I)c2c(c1)CN(C(=O)OC(C)(C)C)CC2
|
COC(=O)c1cc(I)c2c(c1)CN(C(=O)OC(C)(C)C)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.