| Name |
11,14,17-Trioxa-2,8,20-triazahexacosanoic acid, 7-carboxy-26-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-9,21-dioxo-, 1-(1,1-dimethylethyl) ester, (7S)-
|
| Molecular Formula |
C29H48N4O11
|
| Molecular Weight |
628.7
|
| Smiles |
CC(C)(C)OC(=O)NCCCCC(NC(=O)COCCOCCOCCNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O
|
CC(C)(C)OC(=O)NCCCCC(NC(=O)COCCOCCOCCNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.