| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 1-methyl 2-propylpropanedioate
|
| Molecular Formula |
C15H15NO6
|
| Molecular Weight |
305.28
|
| Smiles |
CCCC(C(=O)OC)C(=O)ON1C(=O)c2ccccc2C1=O
|
CCCC(C(=O)OC)C(=O)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.