| Name |
[1-(4,4-Dimethylcyclohexyl)-2,2-dimethylcyclopropyl]methanamine
|
| Molecular Formula |
C14H27N
|
| Molecular Weight |
209.37
|
| Smiles |
CC1(C)CCC(C2(CN)CC2(C)C)CC1
|
CC1(C)CCC(C2(CN)CC2(C)C)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.