| Name |
1-(5-Chloro-2,3-dimethoxyphenyl)-2,2,2-trifluoroethan-1-amine
|
| Molecular Formula |
C10H11ClF3NO2
|
| Molecular Weight |
269.65
|
| Smiles |
COc1cc(Cl)cc(C(N)C(F)(F)F)c1OC
|
COc1cc(Cl)cc(C(N)C(F)(F)F)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.