| Name |
{1-[2,5-dimethyl-1-(2-methylpropyl)-1H-pyrrol-3-yl]-3,3-difluorocyclobutyl}methanamine
|
| Molecular Formula |
C15H24F2N2
|
| Molecular Weight |
270.36
|
| Smiles |
Cc1cc(C2(CN)CC(F)(F)C2)c(C)n1CC(C)C
|
Cc1cc(C2(CN)CC(F)(F)C2)c(C)n1CC(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.