| Name |
7'-Methyl-5'-oxospiro[cyclopropane-1,8'(7'H)-[5H]pyrano[4,3-b]pyridine]-2'-carboxylic acid
|
| Molecular Formula |
C12H11NO4
|
| Molecular Weight |
233.22
|
| Smiles |
CC1OC(=O)c2ccc(C(=O)O)nc2C12CC2
|
CC1OC(=O)c2ccc(C(=O)O)nc2C12CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.