| Name |
(9H-fluoren-9-yl)methyl 4-(3-ethynyl-5-formyl-2,4,6-trimethylphenyl)piperazine-1-carboxylate
|
| Molecular Formula |
C31H30N2O3
|
| Molecular Weight |
478.6
|
| Smiles |
C#Cc1c(C)c(C=O)c(C)c(N2CCN(C(=O)OCC3c4ccccc4-c4ccccc43)CC2)c1C
|
C#Cc1c(C)c(C=O)c(C)c(N2CCN(C(=O)OCC3c4ccccc4-c4ccccc43)CC2)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.