| Name |
2-fluoro-2-{2-methyl-2H,4H,5H,6H-cyclopenta[c]pyrazol-3-yl}acetic acid
|
| Molecular Formula |
C9H11FN2O2
|
| Molecular Weight |
198.19
|
| Smiles |
Cn1nc2c(c1C(F)C(=O)O)CCC2
|
Cn1nc2c(c1C(F)C(=O)O)CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.