| Name |
1-Cyclopropanecarbonyl-4-{7-methylthieno[3,2-d]pyrimidin-4-yl}-1,4-diazepane
|
| Molecular Formula |
C16H20N4OS
|
| Molecular Weight |
316.4
|
| Smiles |
Cc1csc2c(N3CCCN(C(=O)C4CC4)CC3)ncnc12
|
Cc1csc2c(N3CCCN(C(=O)C4CC4)CC3)ncnc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.