| Name |
N-(1-{3-methyl-3H-imidazo[4,5-b]pyridin-2-yl}piperidin-4-yl)methanesulfonamide
|
| Molecular Formula |
C13H19N5O2S
|
| Molecular Weight |
309.39
|
| Smiles |
Cn1c(N2CCC(NS(C)(=O)=O)CC2)nc2cccnc21
|
Cn1c(N2CCC(NS(C)(=O)=O)CC2)nc2cccnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.