| Name |
methyl 4-amino-4-{3H-[1,2,3]triazolo[4,5-b]pyridin-6-yl}butanoate
|
| Molecular Formula |
C10H13N5O2
|
| Molecular Weight |
235.24
|
| Smiles |
COC(=O)CCC(N)c1cnc2n[nH]nc2c1
|
COC(=O)CCC(N)c1cnc2n[nH]nc2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.