| Name |
9H-fluoren-9-ylmethyl 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]azetidine-1-carboxylate
|
| Molecular Formula |
C21H18ClN3O3
|
| Molecular Weight |
395.8
|
| Smiles |
O=C(OCC1c2ccccc2-c2ccccc21)N1CC(c2noc(CCl)n2)C1
|
O=C(OCC1c2ccccc2-c2ccccc21)N1CC(c2noc(CCl)n2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.