| Name |
(3S)-3-{[4-chloro-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}pentanoic acid
|
| Molecular Formula |
C27H25ClN2O5
|
| Molecular Weight |
492.9
|
| Smiles |
CCC(CC(=O)O)NC(=O)c1ccc(Cl)c(NC(=O)OCC2c3ccccc3-c3ccccc32)c1
|
CCC(CC(=O)O)NC(=O)c1ccc(Cl)c(NC(=O)OCC2c3ccccc3-c3ccccc32)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.