| Name |
{6-Chloroimidazo[1,2-a]pyridin-2-yl}methanesulfonyl fluoride
|
| Molecular Formula |
C8H6ClFN2O2S
|
| Molecular Weight |
248.66
|
| Smiles |
O=S(=O)(F)Cc1cn2cc(Cl)ccc2n1
|
O=S(=O)(F)Cc1cn2cc(Cl)ccc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.