| Name |
2,2-difluoro-1-{1H-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-ol
|
| Molecular Formula |
C9H8F2N2O
|
| Molecular Weight |
198.17
|
| Smiles |
OC(c1c[nH]c2ncccc12)C(F)F
|
OC(c1c[nH]c2ncccc12)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.