| Name |
1-Tert-butyl 3-chloromethyl 3-cyanopyrrolidine-1,3-dicarboxylate
|
| Molecular Formula |
C12H17ClN2O4
|
| Molecular Weight |
288.73
|
| Smiles |
CC(C)(C)OC(=O)N1CCC(C#N)(C(=O)OCCl)C1
|
CC(C)(C)OC(=O)N1CCC(C#N)(C(=O)OCCl)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.