| Name |
7-Benzyl-3-propyl-1,8a-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one
|
| Molecular Formula |
C15H18N4O
|
| Molecular Weight |
270.33
|
| Smiles |
CCCC1=NNC2C(=O)N(Cc3ccccc3)C=CN12
|
CCCC1=NNC2C(=O)N(Cc3ccccc3)C=CN12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.