| Name |
Methyl 9-chloro-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-carboxylate
|
| Molecular Formula |
C11H12ClNO3
|
| Molecular Weight |
241.67
|
| Smiles |
COC(=O)c1cc(Cl)c2c(c1)CNCCO2
|
COC(=O)c1cc(Cl)c2c(c1)CNCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.