| Name |
5-tert-butyl 2-methyl 4H,5H,6H-pyrrolo[3,4-d][1,3]thiazole-2,5-dicarboxylate
|
| Molecular Formula |
C12H16N2O4S
|
| Molecular Weight |
284.33
|
| Smiles |
COC(=O)c1nc2c(s1)CN(C(=O)OC(C)(C)C)C2
|
COC(=O)c1nc2c(s1)CN(C(=O)OC(C)(C)C)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.