| Name |
benzyl N-[(2S)-4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]carbamate
|
| Molecular Formula |
C13H13F6NO3
|
| Molecular Weight |
345.24
|
| Smiles |
O=C(NC(CO)C(C(F)(F)F)C(F)(F)F)OCc1ccccc1
|
O=C(NC(CO)C(C(F)(F)F)C(F)(F)F)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.