| Name |
[2-(2,6-Dichloro-5-fluoropyridin-3-yl)propan-2-yl](methyl)amine
|
| Molecular Formula |
C9H11Cl2FN2
|
| Molecular Weight |
237.10
|
| Smiles |
CNC(C)(C)c1cc(F)c(Cl)nc1Cl
|
CNC(C)(C)c1cc(F)c(Cl)nc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.