| Name |
benzyl 3-(hydroxymethyl)-4H,5H,6H,7H-[1,2,3]triazolo[1,5-a]pyrazine-5-carboxylate
|
| Molecular Formula |
C14H16N4O3
|
| Molecular Weight |
288.30
|
| Smiles |
O=C(OCc1ccccc1)N1CCn2nnc(CO)c2C1
|
O=C(OCc1ccccc1)N1CCn2nnc(CO)c2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.