| Name |
6-(4-Amino-2,6-dichlorophenoxy)-4,5-dimethyl-3(2H)-pyridazinone
|
| Molecular Formula |
C12H11Cl2N3O2
|
| Molecular Weight |
300.14
|
| Smiles |
Cc1c(Oc2c(Cl)cc(N)cc2Cl)n[nH]c(=O)c1C
|
Cc1c(Oc2c(Cl)cc(N)cc2Cl)n[nH]c(=O)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.