| Name |
2-((5-Iodo-1H-benzo[d][1,2,3]triazol-1-yl)methyl)tetrahydrothiophene 1,1-dioxide
|
| Molecular Formula |
C11H12IN3O2S
|
| Molecular Weight |
377.20
|
| Smiles |
O=S1(=O)CCCC1Cn1nnc2cc(I)ccc21
|
O=S1(=O)CCCC1Cn1nnc2cc(I)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.