| Name |
4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-2-hydroxybutanoic acid
|
| Molecular Formula |
C23H21N3O6S
|
| Molecular Weight |
467.5
|
| Smiles |
O=C(Nc1ncc(C(=O)NCCC(O)C(=O)O)s1)OCC1c2ccccc2-c2ccccc21
|
O=C(Nc1ncc(C(=O)NCCC(O)C(=O)O)s1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.