| Name |
3-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 1-(9H-fluoren-9-yl)methyl 3-methoxyazetidine-1,3-dicarboxylate
|
| Molecular Formula |
C28H22N2O7
|
| Molecular Weight |
498.5
|
| Smiles |
COC1(C(=O)ON2C(=O)c3ccccc3C2=O)CN(C(=O)OCC2c3ccccc3-c3ccccc32)C1
|
COC1(C(=O)ON2C(=O)c3ccccc3C2=O)CN(C(=O)OCC2c3ccccc3-c3ccccc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.