| Name |
2'-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-YL)-2,3,5,5',6,6'-hexahydrospiro[pyran-4,7'-pyrrolo[3,2-C]pyridin]-4'(1'H)-one
|
| Molecular Formula |
C17H25BN2O4
|
| Molecular Weight |
332.2
|
| Smiles |
CC1(C)OB(c2cc3c([nH]2)C2(CCOCC2)CNC3=O)OC1(C)C
|
CC1(C)OB(c2cc3c([nH]2)C2(CCOCC2)CNC3=O)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.