| Name |
3-(tert-Butyl)-5'-fluoro-2'-methoxy-[1,1'-biphenyl]-4-ol
|
| Molecular Formula |
C17H19FO2
|
| Molecular Weight |
274.33
|
| Smiles |
COc1ccc(F)cc1-c1ccc(O)c(C(C)(C)C)c1
|
COc1ccc(F)cc1-c1ccc(O)c(C(C)(C)C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.