| Name |
5-(1H-1,3-benzodiazol-5-yl)-1,3-oxazolidin-2-one
|
| Molecular Formula |
C10H9N3O2
|
| Molecular Weight |
203.20
|
| Smiles |
O=C1NCC(c2ccc3nc[nH]c3c2)O1
|
O=C1NCC(c2ccc3nc[nH]c3c2)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.