| Name |
(9H-fluoren-9-yl)methyl 4-hydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate
|
| Molecular Formula |
C23H20N2O3
|
| Molecular Weight |
372.4
|
| Smiles |
O=C(OCC1c2ccccc2-c2ccccc21)N1CCC(O)c2cccnc21
|
O=C(OCC1c2ccccc2-c2ccccc21)N1CCC(O)c2cccnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.