| Name |
2-(1-{7-methylthieno[3,2-d]pyrimidin-4-yl}azetidin-3-yl)-2H-1,2,3-triazole
|
| Molecular Formula |
C12H12N6S
|
| Molecular Weight |
272.33
|
| Smiles |
Cc1csc2c(N3CC(n4nccn4)C3)ncnc12
|
Cc1csc2c(N3CC(n4nccn4)C3)ncnc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.