| Name |
1-(Dimethyl-1,3-thiazol-2-yl)pentane-1,3-dione
|
| Molecular Formula |
C10H13NO2S
|
| Molecular Weight |
211.28
|
| Smiles |
CCC(=O)CC(=O)c1nc(C)c(C)s1
|
CCC(=O)CC(=O)c1nc(C)c(C)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.