| Name |
4-{1-[(2-bromo-6-fluoropyridin-3-yl)methyl]-1H-1,2,3-triazol-4-yl}butanoic acid
|
| Molecular Formula |
C12H12BrFN4O2
|
| Molecular Weight |
343.15
|
| Smiles |
O=C(O)CCCc1cn(Cc2ccc(F)nc2Br)nn1
|
O=C(O)CCCc1cn(Cc2ccc(F)nc2Br)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.