| Name |
5-(2-{[(Tert-butoxy)carbonyl]amino}propan-2-yl)-1,2-oxazole-3-carboxylic acid
|
| Molecular Formula |
C12H18N2O5
|
| Molecular Weight |
270.28
|
| Smiles |
CC(C)(C)OC(=O)NC(C)(C)c1cc(C(=O)O)no1
|
CC(C)(C)OC(=O)NC(C)(C)c1cc(C(=O)O)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.