| Name |
3-[(1,1-dioxo-2,3-dihydro-1lambda6-thiophen-3-yl)carbamoyl]-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid
|
| Molecular Formula |
C23H22N2O7S
|
| Molecular Weight |
470.5
|
| Smiles |
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1C=CS(=O)(=O)C1
|
O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC1C=CS(=O)(=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.