| Name |
tert-butyl 6-chloro-1H,2H,3H-pyrido[2,3-b][1,4]oxazine-1-carboxylate
|
| Molecular Formula |
C12H15ClN2O3
|
| Molecular Weight |
270.71
|
| Smiles |
CC(C)(C)OC(=O)N1CCOc2nc(Cl)ccc21
|
CC(C)(C)OC(=O)N1CCOc2nc(Cl)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.