| Name |
benzyl N-{5-iodo-7H-pyrrolo[2,3-d]pyrimidin-4-yl}carbamate
|
| Molecular Formula |
C14H11IN4O2
|
| Molecular Weight |
394.17
|
| Smiles |
O=C(Nc1ncnc2[nH]cc(I)c12)OCc1ccccc1
|
O=C(Nc1ncnc2[nH]cc(I)c12)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.