| Name |
{5-iodo-1-[1-(propan-2-yl)piperidin-4-yl]-1H-1,2,3-triazol-4-yl}methanamine
|
| Molecular Formula |
C11H20IN5
|
| Molecular Weight |
349.21
|
| Smiles |
CC(C)N1CCC(n2nnc(CN)c2I)CC1
|
CC(C)N1CCC(n2nnc(CN)c2I)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.