| Name |
2-(2-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]sulfanyl}acetamido)acetic acid
|
| Molecular Formula |
C21H22N2O5S
|
| Molecular Weight |
414.5
|
| Smiles |
O=C(O)CNC(=O)CSCCNC(=O)OCC1c2ccccc2-c2ccccc21
|
O=C(O)CNC(=O)CSCCNC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.