| Name |
4-[5-(1,2,3,6-tetrahydropyridin-4-yl)-1H-1,2,3-triazol-1-yl]azepane
|
| Molecular Formula |
C13H21N5
|
| Molecular Weight |
247.34
|
| Smiles |
C1=C(c2cnnn2C2CCCNCC2)CCNC1
|
C1=C(c2cnnn2C2CCCNCC2)CCNC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.