| Name |
3-bromo-4-{2-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethoxy]acetamido}benzoic acid
|
| Molecular Formula |
C26H23BrN2O6
|
| Molecular Weight |
539.4
|
| Smiles |
O=C(COCCNC(=O)OCC1c2ccccc2-c2ccccc21)Nc1ccc(C(=O)O)cc1Br
|
O=C(COCCNC(=O)OCC1c2ccccc2-c2ccccc21)Nc1ccc(C(=O)O)cc1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.